C28H37IN2O8 — CID 6719562
(3S,4S,5R)-5-[cycloheptyl(2-oxobutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719562) has the molecular formula C28H37IN2O8 and a molecular weight of 656.51 g/mol. Its IUPAC name is (3S,4S,5R)-5-[cycloheptyl(2-oxobutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[cycloheptyl(2-oxobutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719562 |
| Molecular Formula | C28H37IN2O8 |
| Molecular Weight | 656.51 g/mol |
| Exact Mass | 656.16 |
| IUPAC Name | (3S,4S,5R)-5-[cycloheptyl(2-oxobutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCC(=O)C(=O)N(C1CCCCCC1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C28H37IN2O8/c1-3-22(34)28(37)31(19-8-6-4-5-7-9-19)21-14-18(27(36)30-10-11-32)15-23(25(21)35)39-26-20(29)12-17(16-33)13-24(26)38-2/h12-13,15-16,19,21,23,25,32,35H,3-11,14H2,1-2H3,(H,30,36)/t21-,23+,25+/m1/s1 |
| InChIKey | OIRJUCSVJWFBFB-VTZPFEBOSA-N |
| XLogP | 2.56 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|