C27H37IN2O8 — CID 4157147
5-[cyclohexyl(3-methoxypropanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 4157147) has the molecular formula C27H37IN2O8 and a molecular weight of 644.50 g/mol. Its IUPAC name is 5-[cyclohexyl(3-methoxypropanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[cyclohexyl(3-methoxypropanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4157147 |
| Molecular Formula | C27H37IN2O8 |
| Molecular Weight | 644.50 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | 5-[cyclohexyl(3-methoxypropanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | COCCC(=O)N(C1CCCCC1)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C27H37IN2O8/c1-36-11-8-24(33)30(19-6-4-3-5-7-19)21-14-18(27(35)29-9-10-31)15-22(25(21)34)38-26-20(28)12-17(16-32)13-23(26)37-2/h12-13,15-16,19,21-22,25,31,34H,3-11,14H2,1-2H3,(H,29,35) |
| InChIKey | QEXVDCXSXVLHTN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|