C26H35IN2O8 — CID 6719262
(3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(2-oxobutanoyl)amino]cyclohexene-1-carboxamide (PubChem CID 6719262) has the molecular formula C26H35IN2O8 and a molecular weight of 630.48 g/mol. Its IUPAC name is (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(2-oxobutanoyl)amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(2-oxobutanoyl)amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719262 |
| Molecular Formula | C26H35IN2O8 |
| Molecular Weight | 630.48 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(2-oxobutanoyl)amino]cyclohexene-1-carboxamide |
| SMILES | CCC(=O)C(=O)N(CCC(C)C)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C26H35IN2O8/c1-5-20(32)26(35)29(8-6-15(2)3)19-12-17(25(34)28-7-9-30)13-21(23(19)33)37-24-18(27)10-16(14-31)11-22(24)36-4/h10-11,13-15,19,21,23,30,33H,5-9,12H2,1-4H3,(H,28,34)/t19-,21+,23+/m1/s1 |
| InChIKey | YZDFZTPAKHVKRQ-NWSQWKLXSA-N |
| XLogP | 1.88 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|