C24H33IN2O7 — CID 6719234
(3S,4S,5R)-5-[acetyl(3-methylbutyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719234) has the molecular formula C24H33IN2O7 and a molecular weight of 588.44 g/mol. Its IUPAC name is (3S,4S,5R)-5-[acetyl(3-methylbutyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[acetyl(3-methylbutyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719234 |
| Molecular Formula | C24H33IN2O7 |
| Molecular Weight | 588.44 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | (3S,4S,5R)-5-[acetyl(3-methylbutyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | COc1cc(C=O)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(CCC(C)C)C(C)=O)[C@@H]1O |
| InChI | InChI=1S/C24H33IN2O7/c1-14(2)5-7-27(15(3)30)19-11-17(24(32)26-6-8-28)12-20(22(19)31)34-23-18(25)9-16(13-29)10-21(23)33-4/h9-10,12-14,19-20,22,28,31H,5-8,11H2,1-4H3,(H,26,32)/t19-,20+,22+/m1/s1 |
| InChIKey | BPCLRBVXAGKAJW-URVUXULASA-N |
| XLogP | 1.92 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|