C29H35IN2O7 — CID 6719687
(3S,4S,5R)-5-[benzyl(3-methylbutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719687) has the molecular formula C29H35IN2O7 and a molecular weight of 650.51 g/mol. Its IUPAC name is (3S,4S,5R)-5-[benzyl(3-methylbutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[benzyl(3-methylbutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719687 |
| Molecular Formula | C29H35IN2O7 |
| Molecular Weight | 650.51 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | (3S,4S,5R)-5-[benzyl(3-methylbutanoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | COc1cc(C=O)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(Cc2ccccc2)C(=O)CC(C)C)[C@@H]1O |
| InChI | InChI=1S/C29H35IN2O7/c1-18(2)11-26(35)32(16-19-7-5-4-6-8-19)23-14-21(29(37)31-9-10-33)15-24(27(23)36)39-28-22(30)12-20(17-34)13-25(28)38-3/h4-8,12-13,15,17-18,23-24,27,33,36H,9-11,14,16H2,1-3H3,(H,31,37)/t23-,24+,27+/m1/s1 |
| InChIKey | NCJPIGRHSAURIS-DXBVXKBHSA-N |
| XLogP | 3.10 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|