C27H37IN2O7 — CID 6719244
(3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(pent-2-enoyl)amino]cyclohexene-1-carboxamide (PubChem CID 6719244) has the molecular formula C27H37IN2O7 and a molecular weight of 628.50 g/mol. Its IUPAC name is (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(pent-2-enoyl)amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(pent-2-enoyl)amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719244 |
| Molecular Formula | C27H37IN2O7 |
| Molecular Weight | 628.50 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[3-methylbutyl(pent-2-enoyl)amino]cyclohexene-1-carboxamide |
| SMILES | CCC=CC(=O)N(CCC(C)C)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C27H37IN2O7/c1-5-6-7-24(33)30(10-8-17(2)3)21-14-19(27(35)29-9-11-31)15-22(25(21)34)37-26-20(28)12-18(16-32)13-23(26)36-4/h6-7,12-13,15-17,21-22,25,31,34H,5,8-11,14H2,1-4H3,(H,29,35)/t21-,22+,25+/m1/s1 |
| InChIKey | UXTBBNIGHQEODS-SLSDLSHTSA-N |
| XLogP | 2.87 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|