C29H31Cl2IN2O7 — CID 6719874
(3S,4S,5R)-5-[(2,4-dichlorophenyl)methyl-pent-2-enoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719874) has the molecular formula C29H31Cl2IN2O7 and a molecular weight of 717.38 g/mol. Its IUPAC name is (3S,4S,5R)-5-[(2,4-dichlorophenyl)methyl-pent-2-enoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[(2,4-dichlorophenyl)methyl-pent-2-enoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719874 |
| Molecular Formula | C29H31Cl2IN2O7 |
| Molecular Weight | 717.38 g/mol |
| Exact Mass | 716.06 |
| IUPAC Name | (3S,4S,5R)-5-[(2,4-dichlorophenyl)methyl-pent-2-enoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCC=CC(=O)N(Cc1ccc(Cl)cc1Cl)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C29H31Cl2IN2O7/c1-3-4-5-26(37)34(15-18-6-7-20(30)14-21(18)31)23-12-19(29(39)33-8-9-35)13-24(27(23)38)41-28-22(32)10-17(16-36)11-25(28)40-2/h4-7,10-11,13-14,16,23-24,27,35,38H,3,8-9,12,15H2,1-2H3,(H,33,39)/t23-,24+,27+/m1/s1 |
| InChIKey | HTJAFLYZMLQZHG-DXBVXKBHSA-N |
| XLogP | 4.33 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|