C30H33IN2O9 — CID 6719905
(3S,4S,5R)-5-[1,3-benzodioxol-5-ylmethyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719905) has the molecular formula C30H33IN2O9 and a molecular weight of 692.50 g/mol. Its IUPAC name is (3S,4S,5R)-5-[1,3-benzodioxol-5-ylmethyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[1,3-benzodioxol-5-ylmethyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719905 |
| Molecular Formula | C30H33IN2O9 |
| Molecular Weight | 692.50 g/mol |
| Exact Mass | 692.12 |
| IUPAC Name | (3S,4S,5R)-5-[1,3-benzodioxol-5-ylmethyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | C=CCCC(=O)N(Cc1ccc2c(c1)OCO2)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C30H33IN2O9/c1-3-4-5-27(36)33(15-18-6-7-23-24(11-18)41-17-40-23)22-13-20(30(38)32-8-9-34)14-25(28(22)37)42-29-21(31)10-19(16-35)12-26(29)39-2/h3,6-7,10-12,14,16,22,25,28,34,37H,1,4-5,8-9,13,15,17H2,2H3,(H,32,38)/t22-,25+,28+/m1/s1 |
| InChIKey | FFXNKQTUYNFVBE-ATILKMQGSA-N |
| XLogP | 2.75 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|