C29H37IN2O8 — CID 3428220
5-[furan-3-ylmethyl(hept-6-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide (PubChem CID 3428220) has the molecular formula C29H37IN2O8 and a molecular weight of 668.52 g/mol. Its IUPAC name is 5-[furan-3-ylmethyl(hept-6-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide.
| Compound Name | 5-[furan-3-ylmethyl(hept-6-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 3428220 |
| Molecular Formula | C29H37IN2O8 |
| Molecular Weight | 668.52 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 5-[furan-3-ylmethyl(hept-6-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
| SMILES | C=CCCCCC(=O)N(Cc1ccoc1)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(CO)cc2OC)C1O |
| InChI | InChI=1S/C29H37IN2O8/c1-3-4-5-6-7-26(35)32(16-19-8-11-39-18-19)23-14-21(29(37)31-9-10-33)15-24(27(23)36)40-28-22(30)12-20(17-34)13-25(28)38-2/h3,8,11-13,15,18,23-24,27,33-34,36H,1,4-7,9-10,14,16-17H2,2H3,(H,31,37) |
| InChIKey | WVLARGGIRKGRTG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|