C30H44IN3O8 — CID 3594101
5-[hept-6-enoyl(2-morpholin-4-ylethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide (PubChem CID 3594101) has the molecular formula C30H44IN3O8 and a molecular weight of 701.60 g/mol. Its IUPAC name is 5-[hept-6-enoyl(2-morpholin-4-ylethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide.
| Compound Name | 5-[hept-6-enoyl(2-morpholin-4-ylethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 3594101 |
| Molecular Formula | C30H44IN3O8 |
| Molecular Weight | 701.60 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | 5-[hept-6-enoyl(2-morpholin-4-ylethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
| SMILES | C=CCCCCC(=O)N(CCN1CCOCC1)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(CO)cc2OC)C1O |
| InChI | InChI=1S/C30H44IN3O8/c1-3-4-5-6-7-27(37)34(10-9-33-11-14-41-15-12-33)24-18-22(30(39)32-8-13-35)19-25(28(24)38)42-29-23(31)16-21(20-36)17-26(29)40-2/h3,16-17,19,24-25,28,35-36,38H,1,4-15,18,20H2,2H3,(H,32,39) |
| InChIKey | YOUNLYIESUKWBL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|