C33H43IN2O8 — CID 6721753
(3S,4S,5R)-5-[hept-6-enoyl-[2-(2-methoxyphenyl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide (PubChem CID 6721753) has the molecular formula C33H43IN2O8 and a molecular weight of 722.62 g/mol. Its IUPAC name is (3S,4S,5R)-5-[hept-6-enoyl-[2-(2-methoxyphenyl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[hept-6-enoyl-[2-(2-methoxyphenyl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6721753 |
| Molecular Formula | C33H43IN2O8 |
| Molecular Weight | 722.62 g/mol |
| Exact Mass | 722.21 |
| IUPAC Name | (3S,4S,5R)-5-[hept-6-enoyl-[2-(2-methoxyphenyl)ethyl]amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
| SMILES | C=CCCCCC(=O)N(CCc1ccccc1OC)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(CO)cc2OC)[C@H]1O |
| InChI | InChI=1S/C33H43IN2O8/c1-4-5-6-7-12-30(39)36(15-13-23-10-8-9-11-27(23)42-2)26-19-24(33(41)35-14-16-37)20-28(31(26)40)44-32-25(34)17-22(21-38)18-29(32)43-3/h4,8-11,17-18,20,26,28,31,37-38,40H,1,5-7,12-16,19,21H2,2-3H3,(H,35,41)/t26-,28+,31+/m1/s1 |
| InChIKey | IRJZDQSTFBASIA-RDLJJFNOSA-N |
| XLogP | 3.53 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|