C30H39IN2O5 — CID 6717909
(3S,4S,5R)-5-[benzyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 6717909) has the molecular formula C30H39IN2O5 and a molecular weight of 634.56 g/mol. Its IUPAC name is (3S,4S,5R)-5-[benzyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[benzyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6717909 |
| Molecular Formula | C30H39IN2O5 |
| Molecular Weight | 634.56 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | (3S,4S,5R)-5-[benzyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCCCCCCC(=O)N(Cc1ccccc1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C30H39IN2O5/c1-2-3-4-5-9-16-28(35)33(21-22-12-7-6-8-13-22)25-19-23(30(37)32-17-18-34)20-27(29(25)36)38-26-15-11-10-14-24(26)31/h6-8,10-15,20,25,27,29,34,36H,2-5,9,16-19,21H2,1H3,(H,32,37)/t25-,27+,29+/m1/s1 |
| InChIKey | IXCGAENPOZZDJG-WBJKNQCFSA-N |
| XLogP | 4.60 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|