C22H28F3IN2O5 — CID 6717391
(3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[pentanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide (PubChem CID 6717391) has the molecular formula C22H28F3IN2O5 and a molecular weight of 584.37 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[pentanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[pentanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6717391 |
| Molecular Formula | C22H28F3IN2O5 |
| Molecular Weight | 584.37 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[pentanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide |
| SMILES | CCCCC(=O)N(CC(F)(F)F)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C22H28F3IN2O5/c1-2-3-8-19(30)28(13-22(23,24)25)16-11-14(21(32)27-9-10-29)12-18(20(16)31)33-17-7-5-4-6-15(17)26/h4-7,12,16,18,20,29,31H,2-3,8-11,13H2,1H3,(H,27,32)/t16-,18+,20+/m1/s1 |
| InChIKey | OUNADEWUZZFLEW-KPFFTGBYSA-N |
| XLogP | 2.79 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|