C28H33IN2O5 — CID 6717995
(3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[3-methylbut-2-enoyl-[(4-methylphenyl)methyl]amino]cyclohexene-1-carboxamide (PubChem CID 6717995) has the molecular formula C28H33IN2O5 and a molecular weight of 604.49 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[3-methylbut-2-enoyl-[(4-methylphenyl)methyl]amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[3-methylbut-2-enoyl-[(4-methylphenyl)methyl]amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6717995 |
| Molecular Formula | C28H33IN2O5 |
| Molecular Weight | 604.49 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[3-methylbut-2-enoyl-[(4-methylphenyl)methyl]amino]cyclohexene-1-carboxamide |
| SMILES | CC(C)=CC(=O)N(Cc1ccc(C)cc1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C28H33IN2O5/c1-18(2)14-26(33)31(17-20-10-8-19(3)9-11-20)23-15-21(28(35)30-12-13-32)16-25(27(23)34)36-24-7-5-4-6-22(24)29/h4-11,14,16,23,25,27,32,34H,12-13,15,17H2,1-3H3,(H,30,35)/t23-,25+,27+/m1/s1 |
| InChIKey | UMRLRTGSQWAHLW-NIYJGHKDSA-N |
| XLogP | 3.51 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|