C32H43IN2O8 — CID 4294983
5-[1-adamantylmethyl-(2-ethoxyacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 4294983) has the molecular formula C32H43IN2O8 and a molecular weight of 710.61 g/mol. Its IUPAC name is 5-[1-adamantylmethyl-(2-ethoxyacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[1-adamantylmethyl-(2-ethoxyacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4294983 |
| Molecular Formula | C32H43IN2O8 |
| Molecular Weight | 710.61 g/mol |
| Exact Mass | 710.21 |
| IUPAC Name | 5-[1-adamantylmethyl-(2-ethoxyacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCOCC(=O)N(CC12CC3CC(CC(C3)C1)C2)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C32H43IN2O8/c1-3-42-17-28(38)35(18-32-13-19-6-20(14-32)8-21(7-19)15-32)25-11-23(31(40)34-4-5-36)12-26(29(25)39)43-30-24(33)9-22(16-37)10-27(30)41-2/h9-10,12,16,19-21,25-26,29,36,39H,3-8,11,13-15,17-18H2,1-2H3,(H,34,40) |
| InChIKey | ZHTSRWVXLODEEP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|