C36H40F3IN2O7 — CID 6719617
N-(1-adamantylmethyl)-N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-4-(trifluoromethyl)benzamide (PubChem CID 6719617) has the molecular formula C36H40F3IN2O7 and a molecular weight of 796.62 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-(1-adamantylmethyl)-N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 6719617 |
| Molecular Formula | C36H40F3IN2O7 |
| Molecular Weight | 796.62 g/mol |
| Exact Mass | 796.18 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(C=O)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(CC23CC4CC(CC(C4)C2)C3)C(=O)c2ccc(C(F)(F)F)cc2)[C@@H]1O |
| InChI | InChI=1S/C36H40F3IN2O7/c1-48-30-12-23(18-44)11-27(40)32(30)49-29-14-25(33(46)41-6-7-43)13-28(31(29)45)42(34(47)24-2-4-26(5-3-24)36(37,38)39)19-35-15-20-8-21(16-35)10-22(9-20)17-35/h2-5,11-12,14,18,20-22,28-29,31,43,45H,6-10,13,15-17,19H2,1H3,(H,41,46)/t20?,21?,22?,28-,29+,31+,35?/m1/s1 |
| InChIKey | KPMRRCSORBPATN-YDAGVACESA-N |
| XLogP | 5.41 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|