C34H51IN2O9 — CID 4607697
5-[3-ethoxypropyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 4607697) has the molecular formula C34H51IN2O9 and a molecular weight of 758.69 g/mol. Its IUPAC name is 5-[3-ethoxypropyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[3-ethoxypropyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4607697 |
| Molecular Formula | C34H51IN2O9 |
| Molecular Weight | 758.69 g/mol |
| Exact Mass | 758.26 |
| IUPAC Name | 5-[3-ethoxypropyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCOCCCN(C(=O)COC1CC(C)CCC1C(C)C)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C34H51IN2O9/c1-6-44-13-7-11-37(31(40)20-45-28-14-22(4)8-9-25(28)21(2)3)27-17-24(34(42)36-10-12-38)18-29(32(27)41)46-33-26(35)15-23(19-39)16-30(33)43-5/h15-16,18-19,21-22,25,27-29,32,38,41H,6-14,17,20H2,1-5H3,(H,36,42) |
| InChIKey | OUSPVVAGEURUGU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|