C33H37IN2O9 — CID 5228126
N-[5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-hexyl-2-oxochromene-3-carboxamide (PubChem CID 5228126) has the molecular formula C33H37IN2O9 and a molecular weight of 732.57 g/mol. Its IUPAC name is N-[5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-hexyl-2-oxochromene-3-carboxamide.
| Compound Name | N-[5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-hexyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 5228126 |
| Molecular Formula | C33H37IN2O9 |
| Molecular Weight | 732.57 g/mol |
| Exact Mass | 732.15 |
| IUPAC Name | N-[5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-hexyl-2-oxochromene-3-carboxamide |
| SMILES | CCCCCCN(C(=O)c1cc2ccccc2oc1=O)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C33H37IN2O9/c1-3-4-5-8-12-36(32(41)23-16-21-9-6-7-10-26(21)45-33(23)42)25-17-22(31(40)35-11-13-37)18-27(29(25)39)44-30-24(34)14-20(19-38)15-28(30)43-2/h6-7,9-10,14-16,18-19,25,27,29,37,39H,3-5,8,11-13,17H2,1-2H3,(H,35,40) |
| InChIKey | UBGPQOMAFRRJMT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|