C31H35IN2O7 — CID 6717502
N-hexyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide (PubChem CID 6717502) has the molecular formula C31H35IN2O7 and a molecular weight of 674.53 g/mol. Its IUPAC name is N-hexyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-hexyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 6717502 |
| Molecular Formula | C31H35IN2O7 |
| Molecular Weight | 674.53 g/mol |
| Exact Mass | 674.15 |
| IUPAC Name | N-hexyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
| SMILES | CCCCCCN(C(=O)c1cc2ccccc2oc1=O)C1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C31H35IN2O7/c1-2-3-4-9-15-34(30(38)22-17-20-10-5-7-12-25(20)41-31(22)39)24-18-21(29(37)33-14-16-35)19-27(28(24)36)40-26-13-8-6-11-23(26)32/h5-8,10-13,17,19,24,27-28,35-36H,2-4,9,14-16,18H2,1H3,(H,33,37)/t24?,27-,28-/m0/s1 |
| InChIKey | KGZGDISNGIGVOJ-ACFUZCEKSA-N |
| XLogP | 4.04 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|