C35H35IN2O9 — CID 3687032
N-[2-(2,5-dimethoxyphenyl)ethyl]-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide (PubChem CID 3687032) has the molecular formula C35H35IN2O9 and a molecular weight of 754.57 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)ethyl]-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3687032 |
| Molecular Formula | C35H35IN2O9 |
| Molecular Weight | 754.57 g/mol |
| Exact Mass | 754.14 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(OC)c(CCN(C(=O)c2cc3ccccc3oc2=O)C2CC(C(=O)NCCO)=CC(Oc3ccccc3I)C2O)c1 |
| InChI | InChI=1S/C35H35IN2O9/c1-44-24-11-12-28(45-2)22(17-24)13-15-38(34(42)25-18-21-7-3-5-9-29(21)47-35(25)43)27-19-23(33(41)37-14-16-39)20-31(32(27)40)46-30-10-6-4-8-26(30)36/h3-12,17-18,20,27,31-32,39-40H,13-16,19H2,1-2H3,(H,37,41) |
| InChIKey | OTLPYNHWARQSLB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 147.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|