C32H27Cl2IN2O7 — CID 6718102
N-[(2,4-dichlorophenyl)methyl]-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide (PubChem CID 6718102) has the molecular formula C32H27Cl2IN2O7 and a molecular weight of 749.39 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 6718102 |
| Molecular Formula | C32H27Cl2IN2O7 |
| Molecular Weight | 749.39 g/mol |
| Exact Mass | 748.02 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCO)C1=C[C@H](Oc2ccccc2I)[C@@H](O)[C@H](N(Cc2ccc(Cl)cc2Cl)C(=O)c2cc3ccccc3oc2=O)C1 |
| InChI | InChI=1S/C32H27Cl2IN2O7/c33-21-10-9-19(23(34)16-21)17-37(31(41)22-13-18-5-1-3-7-26(18)44-32(22)42)25-14-20(30(40)36-11-12-38)15-28(29(25)39)43-27-8-4-2-6-24(27)35/h1-10,13,15-16,25,28-29,38-39H,11-12,14,17H2,(H,36,40)/t25-,28+,29+/m1/s1 |
| InChIKey | HBOBGFLIRAVUGG-IGBKUBFESA-N |
| XLogP | 4.96 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|