C32H35IN2O7 — CID 6717772
N-cycloheptyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide (PubChem CID 6717772) has the molecular formula C32H35IN2O7 and a molecular weight of 686.54 g/mol. Its IUPAC name is N-cycloheptyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-cycloheptyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 6717772 |
| Molecular Formula | C32H35IN2O7 |
| Molecular Weight | 686.54 g/mol |
| Exact Mass | 686.15 |
| IUPAC Name | N-cycloheptyl-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCO)C1=C[C@H](Oc2ccccc2I)[C@@H](O)C(N(C(=O)c2cc3ccccc3oc2=O)C2CCCCCC2)C1 |
| InChI | InChI=1S/C32H35IN2O7/c33-24-12-6-8-14-27(24)41-28-19-21(30(38)34-15-16-36)18-25(29(28)37)35(22-10-3-1-2-4-11-22)31(39)23-17-20-9-5-7-13-26(20)42-32(23)40/h5-9,12-14,17,19,22,25,28-29,36-37H,1-4,10-11,15-16,18H2,(H,34,38)/t25?,28-,29-/m0/s1 |
| InChIKey | JBJNTSPRCHKZDG-VAFAGLDHSA-N |
| XLogP | 4.18 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|