C30H43IN2O8 — CID 6719457
(3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[octanoyl-[[(2R)-oxolan-2-yl]methyl]amino]cyclohexene-1-carboxamide (PubChem CID 6719457) has the molecular formula C30H43IN2O8 and a molecular weight of 686.58 g/mol. Its IUPAC name is (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[octanoyl-[[(2R)-oxolan-2-yl]methyl]amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[octanoyl-[[(2R)-oxolan-2-yl]methyl]amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719457 |
| Molecular Formula | C30H43IN2O8 |
| Molecular Weight | 686.58 g/mol |
| Exact Mass | 686.21 |
| IUPAC Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[octanoyl-[[(2R)-oxolan-2-yl]methyl]amino]cyclohexene-1-carboxamide |
| SMILES | CCCCCCCC(=O)N(C[C@H]1CCCO1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C30H43IN2O8/c1-3-4-5-6-7-10-27(36)33(18-22-9-8-13-40-22)24-16-21(30(38)32-11-12-34)17-25(28(24)37)41-29-23(31)14-20(19-35)15-26(29)39-2/h14-15,17,19,22,24-25,28,34,37H,3-13,16,18H2,1-2H3,(H,32,38)/t22-,24-,25+,28+/m1/s1 |
| InChIKey | CPNOEMPTUXXBMJ-HTFRYZPTSA-N |
| XLogP | 3.40 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|