C29H41IN2O6 — CID 4162019
5-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 4162019) has the molecular formula C29H41IN2O6 and a molecular weight of 640.56 g/mol. Its IUPAC name is 5-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | 5-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4162019 |
| Molecular Formula | C29H41IN2O6 |
| Molecular Weight | 640.56 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | 5-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]-(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCOCCCN(C(=O)CC1CC2CCC1C2)C1CC(C(=O)NCCO)=CC(Oc2ccccc2I)C1O |
| InChI | InChI=1S/C29H41IN2O6/c1-2-37-13-5-11-32(27(34)18-21-15-19-8-9-20(21)14-19)24-16-22(29(36)31-10-12-33)17-26(28(24)35)38-25-7-4-3-6-23(25)30/h3-4,6-7,17,19-21,24,26,28,33,35H,2,5,8-16,18H2,1H3,(H,31,36) |
| InChIKey | BSYZKRSETKSNEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|