C29H39IN2O5 — CID 6717807
(3S,4S,5R)-5-[1-adamantylmethyl(propanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 6717807) has the molecular formula C29H39IN2O5 and a molecular weight of 622.54 g/mol. Its IUPAC name is (3S,4S,5R)-5-[1-adamantylmethyl(propanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[1-adamantylmethyl(propanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6717807 |
| Molecular Formula | C29H39IN2O5 |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | (3S,4S,5R)-5-[1-adamantylmethyl(propanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCC(=O)N(CC12CC3CC(CC(C3)C1)C2)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C29H39IN2O5/c1-2-26(34)32(17-29-14-18-9-19(15-29)11-20(10-18)16-29)23-12-21(28(36)31-7-8-33)13-25(27(23)35)37-24-6-4-3-5-22(24)30/h3-6,13,18-20,23,25,27,33,35H,2,7-12,14-17H2,1H3,(H,31,36)/t18?,19?,20?,23-,25+,27+,29?/m1/s1 |
| InChIKey | COKCONSSJXBAES-KNLQPKOCSA-N |
| XLogP | 3.66 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|