C22H19F4N3O3 — CID 42571902
N-[3-(2-fluorophenoxy)propyl]-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 42571902) has the molecular formula C22H19F4N3O3 and a molecular weight of 449.40 g/mol. Its IUPAC name is N-[3-(2-fluorophenoxy)propyl]-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | N-[3-(2-fluorophenoxy)propyl]-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 42571902 |
| Molecular Formula | C22H19F4N3O3 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[3-(2-fluorophenoxy)propyl]-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCCOc2ccccc2F)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F4N3O3/c1-14-12-18(30)20(28-29(14)16-7-4-6-15(13-16)22(24,25)26)21(31)27-10-5-11-32-19-9-3-2-8-17(19)23/h2-4,6-9,12-13H,5,10-11H2,1H3,(H,27,31) |
| InChIKey | ZIBZVLZZGVIRLM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|