C14H17N3O2 — CID 42576885
4-[[(1,5-dimethylpyrazol-4-yl)methylazaniumyl]methyl]benzoate (PubChem CID 42576885) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[[(1,5-dimethylpyrazol-4-yl)methylazaniumyl]methyl]benzoate.
| Compound Name | 4-[[(1,5-dimethylpyrazol-4-yl)methylazaniumyl]methyl]benzoate |
|---|---|
| PubChem CID | 42576885 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-[[(1,5-dimethylpyrazol-4-yl)methylazaniumyl]methyl]benzoate |
| SMILES | Cc1c(C[NH2+]Cc2ccc(C(=O)[O-])cc2)cnn1C |
| InChI | InChI=1S/C14H17N3O2/c1-10-13(9-16-17(10)2)8-15-7-11-3-5-12(6-4-11)14(18)19/h3-6,9,15H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | YMEGHAISHOKRGT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |