C17H14FN3OS2 — CID 42585841
4-amino-3-benzyl-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 42585841) has the molecular formula C17H14FN3OS2 and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-amino-3-benzyl-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-3-benzyl-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 42585841 |
| Molecular Formula | C17H14FN3OS2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-amino-3-benzyl-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | Nc1c(C(=O)Nc2cccc(F)c2)sc(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H14FN3OS2/c18-12-7-4-8-13(9-12)20-16(22)14-15(19)21(17(23)24-14)10-11-5-2-1-3-6-11/h1-9H,10,19H2,(H,20,22) |
| InChIKey | HSAIEKZBKQQORV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|