C18H16FN3O3S2 — CID 46287575
4-amino-3-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 46287575) has the molecular formula C18H16FN3O3S2 and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-amino-3-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-3-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46287575 |
| Molecular Formula | C18H16FN3O3S2 |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-amino-3-(2,4-dimethoxyphenyl)-N-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(-n2c(N)c(C(=O)Nc3cccc(F)c3)sc2=S)c(OC)c1 |
| InChI | InChI=1S/C18H16FN3O3S2/c1-24-12-6-7-13(14(9-12)25-2)22-16(20)15(27-18(22)26)17(23)21-11-5-3-4-10(19)8-11/h3-9H,20H2,1-2H3,(H,21,23) |
| InChIKey | KMDDKYOTYDALKS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|