C18H17N3O2S2 — CID 5141636
4-amino-3-(3-methoxyphenyl)-N-(2-methylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 5141636) has the molecular formula C18H17N3O2S2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 4-amino-3-(3-methoxyphenyl)-N-(2-methylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-3-(3-methoxyphenyl)-N-(2-methylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 5141636 |
| Molecular Formula | C18H17N3O2S2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-amino-3-(3-methoxyphenyl)-N-(2-methylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | COc1cccc(-n2c(N)c(C(=O)Nc3ccccc3C)sc2=S)c1 |
| InChI | InChI=1S/C18H17N3O2S2/c1-11-6-3-4-9-14(11)20-17(22)15-16(19)21(18(24)25-15)12-7-5-8-13(10-12)23-2/h3-10H,19H2,1-2H3,(H,20,22) |
| InChIKey | MKMIFAUASGDINM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|