C19H16KNO3 — CID 71301113
potassium 6-methoxy-3-[(2-methylphenyl)carbamoyl]naphthalen-2-olate (PubChem CID 71301113) has the molecular formula C19H16KNO3 and a molecular weight of 345.44 g/mol. Its IUPAC name is potassium 6-methoxy-3-[(2-methylphenyl)carbamoyl]naphthalen-2-olate.
| Compound Name | potassium 6-methoxy-3-[(2-methylphenyl)carbamoyl]naphthalen-2-olate |
|---|---|
| PubChem CID | 71301113 |
| Molecular Formula | C19H16KNO3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | potassium 6-methoxy-3-[(2-methylphenyl)carbamoyl]naphthalen-2-olate |
| SMILES | COc1ccc2cc([O-])c(C(=O)Nc3ccccc3C)cc2c1.[K+] |
| InChI | InChI=1S/C19H17NO3.K/c1-12-5-3-4-6-17(12)20-19(22)16-10-14-9-15(23-2)8-7-13(14)11-18(16)21;/h3-11,21H,1-2H3,(H,20,22);/q;+1/p-1 |
| InChIKey | FMEHMILBFURYKI-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |