C22H18NNa2O5P — CID 131864598
2-Anthracenecarboxamide, N-(2-methylphenyl)-3-(phosphonooxy)-, sodium salt (1:2) (PubChem CID 131864598) has the molecular formula C22H18NNa2O5P and a molecular weight of 453.34 g/mol.
| Compound Name | 2-Anthracenecarboxamide, N-(2-methylphenyl)-3-(phosphonooxy)-, sodium salt (1:2) |
|---|---|
| PubChem CID | 131864598 |
| Molecular Formula | C22H18NNa2O5P |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1NC(=O)c1cc2cc3ccccc3cc2cc1OP(=O)(O)O.[Na].[Na] |
| InChI | InChI=1S/C22H18NO5P.2Na/c1-14-6-2-5-9-20(14)23-22(24)19-12-17-10-15-7-3-4-8-16(15)11-18(17)13-21(19)28-29(25,26)27;;/h2-13H,1H3,(H,23,24)(H2,25,26,27);; |
| InChIKey | SZSAZOSJYFLPRB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|