C18H15BrNNaO6P — CID 131880000
CID 131880000 (PubChem CID 131880000) has the molecular formula C18H15BrNNaO6P and a molecular weight of 475.19 g/mol.
| Compound Name | CID 131880000 |
|---|---|
| PubChem CID | 131880000 |
| Molecular Formula | C18H15BrNNaO6P |
| Molecular Weight | 475.19 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | — |
| SMILES | COc1ccccc1NC(=O)c1cc2cc(Br)ccc2cc1OP(=O)(O)O.[Na] |
| InChI | InChI=1S/C18H15BrNO6P.Na/c1-25-16-5-3-2-4-15(16)20-18(21)14-9-12-8-13(19)7-6-11(12)10-17(14)26-27(22,23)24;/h2-10H,1H3,(H,20,21)(H2,22,23,24); |
| InChIKey | WNXNLUSSGAHEKK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|