C18H13BrNO6S- — CID 51386880
[6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl] sulfate (PubChem CID 51386880) has the molecular formula C18H13BrNO6S- and a molecular weight of 451.27 g/mol. Its IUPAC name is [6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl] sulfate.
| Compound Name | [6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl] sulfate |
|---|---|
| PubChem CID | 51386880 |
| Molecular Formula | C18H13BrNO6S- |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | [6-bromo-3-[(2-methoxyphenyl)carbamoyl]naphthalen-2-yl] sulfate |
| SMILES | COc1ccccc1NC(=O)c1cc2cc(Br)ccc2cc1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H14BrNO6S/c1-25-16-5-3-2-4-15(16)20-18(21)14-9-12-8-13(19)7-6-11(12)10-17(14)26-27(22,23)24/h2-10H,1H3,(H,20,21)(H,22,23,24)/p-1 |
| InChIKey | CMCVVKFDSKVNOX-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|