C26H27BrN2O8 — CID 98046988
3-[(2S,3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-bromo-N-(2-methoxyphenyl)naphthalene-2-carboxamide (PubChem CID 98046988) has the molecular formula C26H27BrN2O8 and a molecular weight of 575.41 g/mol. Its IUPAC name is 3-[(2S,3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-bromo-N-(2-methoxyphenyl)naphthalene-2-carboxamide.
| Compound Name | 3-[(2S,3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-bromo-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 98046988 |
| Molecular Formula | C26H27BrN2O8 |
| Molecular Weight | 575.41 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 3-[(2S,3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-bromo-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2cc(Br)ccc2cc1O[C@@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C26H27BrN2O8/c1-13(31)28-22-24(33)23(32)21(12-30)37-26(22)36-20-11-14-7-8-16(27)9-15(14)10-17(20)25(34)29-18-5-3-4-6-19(18)35-2/h3-11,21-24,26,30,32-33H,12H2,1-2H3,(H,28,31)(H,29,34)/t21-,22+,23-,24-,26+/m0/s1 |
| InChIKey | DMLKUPXKUQREOC-AOYLRGCGSA-N |
| XLogP | 2.19 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |