C19H17ClNO5P — CID 123775354
[3-[(4-chloro-2-methylphenyl)carbamoyl]naphthalen-2-yl] methyl hydrogen phosphate (PubChem CID 123775354) has the molecular formula C19H17ClNO5P and a molecular weight of 405.77 g/mol. Its IUPAC name is [3-[(4-chloro-2-methylphenyl)carbamoyl]naphthalen-2-yl] methyl hydrogen phosphate.
| Compound Name | [3-[(4-chloro-2-methylphenyl)carbamoyl]naphthalen-2-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 123775354 |
| Molecular Formula | C19H17ClNO5P |
| Molecular Weight | 405.77 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | [3-[(4-chloro-2-methylphenyl)carbamoyl]naphthalen-2-yl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)Oc1cc2ccccc2cc1C(=O)Nc1ccc(Cl)cc1C |
| InChI | InChI=1S/C19H17ClNO5P/c1-12-9-15(20)7-8-17(12)21-19(22)16-10-13-5-3-4-6-14(13)11-18(16)26-27(23,24)25-2/h3-11H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | LOALFNCYCLZEEN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.77 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|