C22H21ClN4O3 — CID 42586493
(3aR,4R,7aS)-6-amino-4-[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]-3-methyl-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 42586493) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is (3aR,4R,7aS)-6-amino-4-[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]-3-methyl-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (3aR,4R,7aS)-6-amino-4-[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]-3-methyl-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 42586493 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (3aR,4R,7aS)-6-amino-4-[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]-3-methyl-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1ccc([C@@H]2C(C#N)=C(N)O[C@@H]3NN=C(C)[C@H]32)cc1COc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClN4O3/c1-12-19-20(17(10-24)21(25)30-22(19)27-26-12)13-6-7-18(28-2)14(8-13)11-29-16-5-3-4-15(23)9-16/h3-9,19-20,22,27H,11,25H2,1-2H3/t19-,20+,22-/m0/s1 |
| InChIKey | NMDFNKWTLVINMX-VWPQPMDRSA-N |
| XLogP | 3.66 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |