C15H13F3N4O2 — CID 124924462
(3aR,4R,7aR)-6-amino-4-(4-methoxyphenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 124924462) has the molecular formula C15H13F3N4O2 and a molecular weight of 338.29 g/mol. Its IUPAC name is (3aR,4R,7aR)-6-amino-4-(4-methoxyphenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (3aR,4R,7aR)-6-amino-4-(4-methoxyphenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 124924462 |
| Molecular Formula | C15H13F3N4O2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (3aR,4R,7aR)-6-amino-4-(4-methoxyphenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1ccc([C@@H]2C(C#N)=C(N)O[C@H]3NN=C(C(F)(F)F)[C@H]32)cc1 |
| InChI | InChI=1S/C15H13F3N4O2/c1-23-8-4-2-7(3-5-8)10-9(6-19)13(20)24-14-11(10)12(21-22-14)15(16,17)18/h2-5,10-11,14,22H,20H2,1H3/t10-,11-,14-/m1/s1 |
| InChIKey | WYEWJZSHVXDDKU-JTNHKYCSSA-N |
| XLogP | 1.97 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |