C14H10ClF3N4O — CID 40547096
(3aR,4R,7aS)-6-amino-4-(2-chlorophenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 40547096) has the molecular formula C14H10ClF3N4O and a molecular weight of 342.71 g/mol. Its IUPAC name is (3aR,4R,7aS)-6-amino-4-(2-chlorophenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (3aR,4R,7aS)-6-amino-4-(2-chlorophenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 40547096 |
| Molecular Formula | C14H10ClF3N4O |
| Molecular Weight | 342.71 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (3aR,4R,7aS)-6-amino-4-(2-chlorophenyl)-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)O[C@@H]2NN=C(C(F)(F)F)[C@H]2[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C14H10ClF3N4O/c15-8-4-2-1-3-6(8)9-7(5-19)12(20)23-13-10(9)11(21-22-13)14(16,17)18/h1-4,9-10,13,22H,20H2/t9-,10+,13-/m0/s1 |
| InChIKey | SOVOGRRNXZFYMJ-CWSCBRNRSA-N |
| XLogP | 2.61 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.71 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |