C14H15ClN4O — CID 71628556
6-amino-4-(2-chlorophenyl)-3-methyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 71628556) has the molecular formula C14H15ClN4O and a molecular weight of 290.75 g/mol. Its IUPAC name is 6-amino-4-(2-chlorophenyl)-3-methyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(2-chlorophenyl)-3-methyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 71628556 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 6-amino-4-(2-chlorophenyl)-3-methyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CC1NNC2OC(N)=C(C#N)C(c3ccccc3Cl)C12 |
| InChI | InChI=1S/C14H15ClN4O/c1-7-11-12(8-4-2-3-5-10(8)15)9(6-16)13(17)20-14(11)19-18-7/h2-5,7,11-12,14,18-19H,17H2,1H3 |
| InChIKey | ISKRIIXALQULQN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |