C18H24N4O5 — CID 78255798
6-amino-3-(methoxymethyl)-4-(2,4,5-trimethoxyphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 78255798) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 6-amino-3-(methoxymethyl)-4-(2,4,5-trimethoxyphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-(methoxymethyl)-4-(2,4,5-trimethoxyphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 78255798 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 6-amino-3-(methoxymethyl)-4-(2,4,5-trimethoxyphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COCC1NNC2OC(N)=C(C#N)C(c3cc(OC)c(OC)cc3OC)C12 |
| InChI | InChI=1S/C18H24N4O5/c1-23-8-11-16-15(10(7-19)17(20)27-18(16)22-21-11)9-5-13(25-3)14(26-4)6-12(9)24-2/h5-6,11,15-16,18,21-22H,8,20H2,1-4H3 |
| InChIKey | OTDJSMUVLHKMEF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |