C17H22N4O4 — CID 78207804
6-amino-4-(3,5-dimethoxyphenyl)-3-(methoxymethyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 78207804) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 6-amino-4-(3,5-dimethoxyphenyl)-3-(methoxymethyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(3,5-dimethoxyphenyl)-3-(methoxymethyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 78207804 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 6-amino-4-(3,5-dimethoxyphenyl)-3-(methoxymethyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COCC1NNC2OC(N)=C(C#N)C(c3cc(OC)cc(OC)c3)C12 |
| InChI | InChI=1S/C17H22N4O4/c1-22-8-13-15-14(9-4-10(23-2)6-11(5-9)24-3)12(7-18)16(19)25-17(15)21-20-13/h4-6,13-15,17,20-21H,8,19H2,1-3H3 |
| InChIKey | OEEGYNIQKMUMFM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |