C19H18IN5O2 — CID 156907812
6-amino-4-(3-iodo-4-methoxyphenyl)-3-pyridin-3-yl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 156907812) has the molecular formula C19H18IN5O2 and a molecular weight of 475.29 g/mol. Its IUPAC name is 6-amino-4-(3-iodo-4-methoxyphenyl)-3-pyridin-3-yl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(3-iodo-4-methoxyphenyl)-3-pyridin-3-yl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 156907812 |
| Molecular Formula | C19H18IN5O2 |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 6-amino-4-(3-iodo-4-methoxyphenyl)-3-pyridin-3-yl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)OC3NNC(c4cccnc4)C32)cc1I |
| InChI | InChI=1S/C19H18IN5O2/c1-26-14-5-4-10(7-13(14)20)15-12(8-21)18(22)27-19-16(15)17(24-25-19)11-3-2-6-23-9-11/h2-7,9,15-17,19,24-25H,22H2,1H3 |
| InChIKey | MTZLJOJHYZRULV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|