C23H26N4O2 — CID 53447712
6-amino-3-(4-ethoxyphenyl)-4-(4-ethylphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 53447712) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 6-amino-3-(4-ethoxyphenyl)-4-(4-ethylphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-(4-ethoxyphenyl)-4-(4-ethylphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 53447712 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 6-amino-3-(4-ethoxyphenyl)-4-(4-ethylphenyl)-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CCOc1ccc(C2NNC3OC(N)=C(C#N)C(c4ccc(CC)cc4)C32)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-3-14-5-7-15(8-6-14)19-18(13-24)22(25)29-23-20(19)21(26-27-23)16-9-11-17(12-10-16)28-4-2/h5-12,19-21,23,26-27H,3-4,25H2,1-2H3 |
| InChIKey | CURJODDEVQLPPR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |