C22H21F3N4O3 — CID 78223973
6-amino-3-(3,4-dimethoxyphenyl)-4-[4-(trifluoromethyl)phenyl]-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 78223973) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is 6-amino-3-(3,4-dimethoxyphenyl)-4-[4-(trifluoromethyl)phenyl]-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-(3,4-dimethoxyphenyl)-4-[4-(trifluoromethyl)phenyl]-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 78223973 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 6-amino-3-(3,4-dimethoxyphenyl)-4-[4-(trifluoromethyl)phenyl]-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1ccc(C2NNC3OC(N)=C(C#N)C(c4ccc(C(F)(F)F)cc4)C32)cc1OC |
| InChI | InChI=1S/C22H21F3N4O3/c1-30-15-8-5-12(9-16(15)31-2)19-18-17(11-3-6-13(7-4-11)22(23,24)25)14(10-26)20(27)32-21(18)29-28-19/h3-9,17-19,21,28-29H,27H2,1-2H3 |
| InChIKey | XIOHEGVDPLUWLI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |