C14H11F3N4O — CID 40548715
(3aR,4S,7aS)-6-amino-4-phenyl-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 40548715) has the molecular formula C14H11F3N4O and a molecular weight of 308.26 g/mol. Its IUPAC name is (3aR,4S,7aS)-6-amino-4-phenyl-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (3aR,4S,7aS)-6-amino-4-phenyl-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 40548715 |
| Molecular Formula | C14H11F3N4O |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (3aR,4S,7aS)-6-amino-4-phenyl-3-(trifluoromethyl)-1,3a,4,7a-tetrahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)O[C@@H]2NN=C(C(F)(F)F)[C@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H11F3N4O/c15-14(16,17)11-10-9(7-4-2-1-3-5-7)8(6-18)12(19)22-13(10)21-20-11/h1-5,9-10,13,21H,19H2/t9-,10+,13-/m0/s1 |
| InChIKey | ZXKXTOPNRNSCHI-CWSCBRNRSA-N |
| XLogP | 1.96 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |