C18H33NO3 — CID 42589268
1-[(2R)-2-hydroxy-3-[(3S)-3-methylpent-1-yn-3-yl]oxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 42589268) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-[(3S)-3-methylpent-1-yn-3-yl]oxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[(2R)-2-hydroxy-3-[(3S)-3-methylpent-1-yn-3-yl]oxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 42589268 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-[(3S)-3-methylpent-1-yn-3-yl]oxypropyl]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | C#C[C@](C)(CC)OC[C@H](O)CN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C18H33NO3/c1-8-18(7,9-2)22-13-15(21)12-19-16(3,4)10-14(20)11-17(19,5)6/h1,14-15,20-21H,9-13H2,2-7H3/t15-,18-/m1/s1 |
| InChIKey | UPMWKRCNVAHMBF-CRAIPNDOSA-N |
| XLogP | 2.18 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|