C21H18F3N3O4S — CID 42590424
3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 42590424) has the molecular formula C21H18F3N3O4S and a molecular weight of 465.45 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 42590424 |
| Molecular Formula | C21H18F3N3O4S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | O=C(C[C@H]1Sc2ccc(C(F)(F)F)cc2NC1=O)OCCCn1c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C21H18F3N3O4S/c22-21(23,24)12-6-7-16-14(10-12)25-19(29)17(32-16)11-18(28)31-9-3-8-27-15-5-2-1-4-13(15)26-20(27)30/h1-2,4-7,10,17H,3,8-9,11H2,(H,25,29)(H,26,30)/t17-/m1/s1 |
| InChIKey | WWRYJUNGBLCXSR-QGZVFWFLSA-N |
| XLogP | 3.78 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|