C19H18FN3 — CID 4259434
N-benzyl-6-(4-fluorophenyl)-N,2-dimethylpyrimidin-4-amine (PubChem CID 4259434) has the molecular formula C19H18FN3 and a molecular weight of 307.37 g/mol. Its IUPAC name is N-benzyl-6-(4-fluorophenyl)-N,2-dimethylpyrimidin-4-amine.
| Compound Name | N-benzyl-6-(4-fluorophenyl)-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 4259434 |
| Molecular Formula | C19H18FN3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-benzyl-6-(4-fluorophenyl)-N,2-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccc(F)cc2)cc(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H18FN3/c1-14-21-18(16-8-10-17(20)11-9-16)12-19(22-14)23(2)13-15-6-4-3-5-7-15/h3-12H,13H2,1-2H3 |
| InChIKey | KZUAPPJSFVTLOZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |