C18H21N5O2 — CID 42595070
(2R)-1-N-prop-2-enyl-2-N-(3-pyrazol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 42595070) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (2R)-1-N-prop-2-enyl-2-N-(3-pyrazol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-prop-2-enyl-2-N-(3-pyrazol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 42595070 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R)-1-N-prop-2-enyl-2-N-(3-pyrazol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)N1CCC[C@@H]1C(=O)Nc1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H21N5O2/c1-2-9-19-18(25)22-11-4-8-16(22)17(24)21-14-6-3-7-15(13-14)23-12-5-10-20-23/h2-3,5-7,10,12-13,16H,1,4,8-9,11H2,(H,19,25)(H,21,24)/t16-/m1/s1 |
| InChIKey | FAZSARZLSFRGMZ-MRXNPFEDSA-N |
| XLogP | 2.17 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|